C23H46O7Si — CID 42600665
methyl (2R,3S,4S,5S)-7-acetyloxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate (PubChem CID 42600665) has the molecular formula C23H46O7Si and a molecular weight of 462.70 g/mol. Its IUPAC name is methyl (2R,3S,4S,5S)-7-acetyloxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate.
| Compound Name | methyl (2R,3S,4S,5S)-7-acetyloxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate |
|---|---|
| PubChem CID | 42600665 |
| Molecular Formula | C23H46O7Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | methyl (2R,3S,4S,5S)-7-acetyloxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate |
| SMILES | COCO[C@@H](CCOC(C)=O)[C@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C23H46O7Si/c1-15(2)31(16(3)4,17(5)6)30-22(19(8)23(25)27-11)18(7)21(29-14-26-10)12-13-28-20(9)24/h15-19,21-22H,12-14H2,1-11H3/t18-,19+,21-,22-/m0/s1 |
| InChIKey | ZERSPNFMCUGYTR-MXNKGDRCSA-N |
| XLogP | 4.93 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|