C21H44O6Si — CID 42600666
methyl (2R,3S,4S,5S)-7-hydroxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate (PubChem CID 42600666) has the molecular formula C21H44O6Si and a molecular weight of 420.66 g/mol. Its IUPAC name is methyl (2R,3S,4S,5S)-7-hydroxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate.
| Compound Name | methyl (2R,3S,4S,5S)-7-hydroxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate |
|---|---|
| PubChem CID | 42600666 |
| Molecular Formula | C21H44O6Si |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | methyl (2R,3S,4S,5S)-7-hydroxy-5-(methoxymethoxy)-2,4-dimethyl-3-tri(propan-2-yl)silyloxyheptanoate |
| SMILES | COCO[C@@H](CCO)[C@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C21H44O6Si/c1-14(2)28(15(3)4,16(5)6)27-20(18(8)21(23)25-10)17(7)19(11-12-22)26-13-24-9/h14-20,22H,11-13H2,1-10H3/t17-,18+,19-,20-/m0/s1 |
| InChIKey | CZBXIHJPUVBWCJ-YRPNKDGESA-N |
| XLogP | 4.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|