C23H50O5SeSi2 — CID 134831895
methyl (2S,3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4-dimethyl-2-methylselanylheptanoate (PubChem CID 134831895) has the molecular formula C23H50O5SeSi2 and a molecular weight of 541.78 g/mol. Its IUPAC name is methyl (2S,3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4-dimethyl-2-methylselanylheptanoate.
| Compound Name | methyl (2S,3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4-dimethyl-2-methylselanylheptanoate |
|---|---|
| PubChem CID | 134831895 |
| Molecular Formula | C23H50O5SeSi2 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | methyl (2S,3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4-dimethyl-2-methylselanylheptanoate |
| SMILES | COC(=O)[C@@](C)([Se]C)[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O5SeSi2/c1-16(19(24)23(9,29-11)20(25)26-10)18(28-31(14,15)22(6,7)8)17(2)27-30(12,13)21(3,4)5/h16-19,24H,1-15H3/t16-,17+,18-,19+,23-/m0/s1 |
| InChIKey | CECJUDCMHACEOP-ZGHDPVSRSA-N |
| XLogP | 5.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|