C24H46O5Si — CID 134904415
methyl (2R,4S,5R,6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxooctanoate (PubChem CID 134904415) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is methyl (2R,4S,5R,6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxooctanoate.
| Compound Name | methyl (2R,4S,5R,6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxooctanoate |
|---|---|
| PubChem CID | 134904415 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | methyl (2R,4S,5R,6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxooctanoate |
| SMILES | COC(=O)[C@H](C)C[C@H](C)[C@@H](O)[C@H](C)C(=O)[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C24H46O5Si/c1-16(15-17(2)23(27)28-7)20(25)18(3)21(26)22(19-13-11-10-12-14-19)29-30(8,9)24(4,5)6/h16-20,22,25H,10-15H2,1-9H3/t16-,17+,18-,20+,22+/m0/s1 |
| InChIKey | SYPVHACJDGUIAL-FIEIAYSHSA-N |
| XLogP | 5.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|