C17H36O5Si — CID 10893444
methyl (2S,3R,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroxy-4-methylhexanoate (PubChem CID 10893444) has the molecular formula C17H36O5Si and a molecular weight of 348.56 g/mol. Its IUPAC name is methyl (2S,3R,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroxy-4-methylhexanoate.
| Compound Name | methyl (2S,3R,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroxy-4-methylhexanoate |
|---|---|
| PubChem CID | 10893444 |
| Molecular Formula | C17H36O5Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (2S,3R,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroxy-4-methylhexanoate |
| SMILES | CC[C@H](C)[C@@H](O)[C@@](O)(CCCO[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C17H36O5Si/c1-9-13(2)14(18)17(20,15(19)21-6)11-10-12-22-23(7,8)16(3,4)5/h13-14,18,20H,9-12H2,1-8H3/t13-,14+,17-/m0/s1 |
| InChIKey | XCLCTMKCIKSVRX-VBQJREDUSA-N |
| XLogP | 3.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|