C21H44O8Si2 — CID 134944757
diethyl 2-(3,4-dihydroxy-1-triethylsilyloxypentan-2-yl)-2-trimethylsilyloxypropanedioate (PubChem CID 134944757) has the molecular formula C21H44O8Si2 and a molecular weight of 480.75 g/mol. Its IUPAC name is diethyl 2-(3,4-dihydroxy-1-triethylsilyloxypentan-2-yl)-2-trimethylsilyloxypropanedioate.
| Compound Name | diethyl 2-(3,4-dihydroxy-1-triethylsilyloxypentan-2-yl)-2-trimethylsilyloxypropanedioate |
|---|---|
| PubChem CID | 134944757 |
| Molecular Formula | C21H44O8Si2 |
| Molecular Weight | 480.75 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | diethyl 2-(3,4-dihydroxy-1-triethylsilyloxypentan-2-yl)-2-trimethylsilyloxypropanedioate |
| SMILES | CCOC(=O)C(O[Si](C)(C)C)(C(=O)OCC)C(CO[Si](CC)(CC)CC)C(O)C(C)O |
| InChI | InChI=1S/C21H44O8Si2/c1-10-26-19(24)21(20(25)27-11-2,29-30(7,8)9)17(18(23)16(6)22)15-28-31(12-3,13-4)14-5/h16-18,22-23H,10-15H2,1-9H3 |
| InChIKey | CQXVIONCPAYLBM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|