C17H36O8Si3 — CID 90776577
5-(1,2-dihydroxyethyl)-4-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,3-dione (PubChem CID 90776577) has the molecular formula C17H36O8Si3 and a molecular weight of 452.73 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-4-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,3-dione.
| Compound Name | 5-(1,2-dihydroxyethyl)-4-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,3-dione |
|---|---|
| PubChem CID | 90776577 |
| Molecular Formula | C17H36O8Si3 |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-4-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,3-dione |
| SMILES | CC(COC1C(=O)C(=O)OC1C(O)CO)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O8Si3/c1-12(11-28(8,24-26(2,3)4)25-27(5,6)7)10-22-16-14(20)17(21)23-15(16)13(19)9-18/h12-13,15-16,18-19H,9-11H2,1-8H3 |
| InChIKey | ZPEMYMWNUZICLQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|