C19H38O7Si2 — CID 134944790
ethyl (5R)-5-[(1S)-1-hydroxyethyl]-2-oxo-4-(triethylsilyloxymethyl)-3-trimethylsilyloxyoxolane-3-carboxylate (PubChem CID 134944790) has the molecular formula C19H38O7Si2 and a molecular weight of 434.68 g/mol. Its IUPAC name is ethyl (5R)-5-[(1S)-1-hydroxyethyl]-2-oxo-4-(triethylsilyloxymethyl)-3-trimethylsilyloxyoxolane-3-carboxylate.
| Compound Name | ethyl (5R)-5-[(1S)-1-hydroxyethyl]-2-oxo-4-(triethylsilyloxymethyl)-3-trimethylsilyloxyoxolane-3-carboxylate |
|---|---|
| PubChem CID | 134944790 |
| Molecular Formula | C19H38O7Si2 |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | ethyl (5R)-5-[(1S)-1-hydroxyethyl]-2-oxo-4-(triethylsilyloxymethyl)-3-trimethylsilyloxyoxolane-3-carboxylate |
| SMILES | CCOC(=O)C1(O[Si](C)(C)C)C(=O)O[C@@H]([C@H](C)O)C1CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H38O7Si2/c1-9-23-17(21)19(26-27(6,7)8)15(16(14(5)20)25-18(19)22)13-24-28(10-2,11-3)12-4/h14-16,20H,9-13H2,1-8H3/t14-,15?,16-,19?/m0/s1 |
| InChIKey | RUTFCNZNXFCKSJ-QCTRZYONSA-N |
| XLogP | 3.08 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|