C18H36O7Si — CID 134971288
methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-4-methyl-5-triethylsilyloxypentanoate (PubChem CID 134971288) has the molecular formula C18H36O7Si and a molecular weight of 392.57 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-4-methyl-5-triethylsilyloxypentanoate.
| Compound Name | methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-4-methyl-5-triethylsilyloxypentanoate |
|---|---|
| PubChem CID | 134971288 |
| Molecular Formula | C18H36O7Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl (2R,3S,4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-4-methyl-5-triethylsilyloxypentanoate |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@H](O)[C@@H](O)C(=O)OC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H36O7Si/c1-8-26(9-2,10-3)25-16(13-11-23-18(5,6)24-13)12(4)14(19)15(20)17(21)22-7/h12-16,19-20H,8-11H2,1-7H3/t12-,13-,14-,15+,16+/m0/s1 |
| InChIKey | HHKGFYAFDFHPKX-RFBLXINOSA-N |
| XLogP | 2.06 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|