C16H34O5Si — CID 23642893
ethyl (2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanoate (PubChem CID 23642893) has the molecular formula C16H34O5Si and a molecular weight of 334.53 g/mol. Its IUPAC name is ethyl (2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanoate.
| Compound Name | ethyl (2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanoate |
|---|---|
| PubChem CID | 23642893 |
| Molecular Formula | C16H34O5Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | ethyl (2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanoate |
| SMILES | CCC[C@H](C[C@@H](O)[C@H](O)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O5Si/c1-8-10-12(21-22(6,7)16(3,4)5)11-13(17)14(18)15(19)20-9-2/h12-14,17-18H,8-11H2,1-7H3/t12-,13-,14+/m1/s1 |
| InChIKey | SLOFBVISMXYJTH-MCIONIFRSA-N |
| XLogP | 2.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|