C15H30O5 — CID 102429718
methyl (2S,3R,5S)-2,3,5-trihydroxytetradecanoate (PubChem CID 102429718) has the molecular formula C15H30O5 and a molecular weight of 290.40 g/mol. Its IUPAC name is methyl (2S,3R,5S)-2,3,5-trihydroxytetradecanoate.
| Compound Name | methyl (2S,3R,5S)-2,3,5-trihydroxytetradecanoate |
|---|---|
| PubChem CID | 102429718 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | methyl (2S,3R,5S)-2,3,5-trihydroxytetradecanoate |
| SMILES | CCCCCCCCC[C@H](O)C[C@@H](O)[C@H](O)C(=O)OC |
| InChI | InChI=1S/C15H30O5/c1-3-4-5-6-7-8-9-10-12(16)11-13(17)14(18)15(19)20-2/h12-14,16-18H,3-11H2,1-2H3/t12-,13+,14-/m0/s1 |
| InChIKey | RMZHRCHXTBTPGS-MJBXVCDLSA-N |
| XLogP | 1.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|