About 2,3-dihydroxypropyl 5-hydroxydecanoate
2,3-dihydroxypropyl 5-hydroxydecanoate (PubChem CID 5463954) has the molecular formula C13H26O5
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 5-hydroxydecanoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl 5-hydroxydecanoate |
| PubChem CID | 5463954 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2,3-dihydroxypropyl 5-hydroxydecanoate |
| SMILES | CCCCCC(O)CCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C13H26O5/c1-2-3-4-6-11(15)7-5-8-13(17)18-10-12(16)9-14/h11-12,14-16H,2-10H2,1H3 |
| InChIKey | ILJDYMFZBMWGGZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl 5-hydroxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl 5-hydroxydecanoate?
The IUPAC name of 2,3-dihydroxypropyl 5-hydroxydecanoate (CID 5463954) is 2,3-dihydroxypropyl 5-hydroxydecanoate.
What is the SMILES notation for 2,3-dihydroxypropyl 5-hydroxydecanoate?
The canonical SMILES for 2,3-dihydroxypropyl 5-hydroxydecanoate is CCCCCC(O)CCCC(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl 5-hydroxydecanoate?
The InChIKey is ILJDYMFZBMWGGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5/c1-2-3-4-6-11(15)7-5-8-13(17)18-10-12(16)9-14/h11-12,14-16H,2-10H2,1H3.
What are the key properties of 2,3-dihydroxypropyl 5-hydroxydecanoate?
2,3-dihydroxypropyl 5-hydroxydecanoate has a molecular weight of 262.35 g/mol, XLogP of 0.99, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl 5-hydroxydecanoate is sourced from PubChem (CID 5463954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).