About 2,3-dihydroxypropyl dodecanoate
2,3-dihydroxypropyl dodecanoate (PubChem CID 14871) has the molecular formula C15H30O4
and a molecular weight of 274.40 g/mol. Its IUPAC name is 2,3-dihydroxypropyl dodecanoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl dodecanoate |
| PubChem CID | 14871 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 2,3-dihydroxypropyl dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-13-14(17)12-16/h14,16-17H,2-13H2,1H3 |
| InChIKey | ARIWANIATODDMH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl dodecanoate?
The IUPAC name of 2,3-dihydroxypropyl dodecanoate (CID 14871) is 2,3-dihydroxypropyl dodecanoate.
What is the SMILES notation for 2,3-dihydroxypropyl dodecanoate?
The canonical SMILES for 2,3-dihydroxypropyl dodecanoate is CCCCCCCCCCCC(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl dodecanoate?
The InChIKey is ARIWANIATODDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-13-14(17)12-16/h14,16-17H,2-13H2,1H3.
What are the key properties of 2,3-dihydroxypropyl dodecanoate?
2,3-dihydroxypropyl dodecanoate has a molecular weight of 274.40 g/mol, XLogP of 2.80, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl dodecanoate is sourced from PubChem (CID 14871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).