About 2,3-dihydroxypropyl hexadecanoate
2,3-dihydroxypropyl hexadecanoate (PubChem CID 14900) has the molecular formula C19H38O4
and a molecular weight of 330.51 g/mol. Its IUPAC name is 2,3-dihydroxypropyl hexadecanoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl hexadecanoate |
| PubChem CID | 14900 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 2,3-dihydroxypropyl hexadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3 |
| InChIKey | QHZLMUACJMDIAE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl hexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl hexadecanoate?
The IUPAC name of 2,3-dihydroxypropyl hexadecanoate (CID 14900) is 2,3-dihydroxypropyl hexadecanoate.
What is the SMILES notation for 2,3-dihydroxypropyl hexadecanoate?
The canonical SMILES for 2,3-dihydroxypropyl hexadecanoate is CCCCCCCCCCCCCCCC(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl hexadecanoate?
The InChIKey is QHZLMUACJMDIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3.
What are the key properties of 2,3-dihydroxypropyl hexadecanoate?
2,3-dihydroxypropyl hexadecanoate has a molecular weight of 330.51 g/mol, XLogP of 4.36, 17 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl hexadecanoate is sourced from PubChem (CID 14900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).