C27H54O8Si2 — CID 10886253
8-O-tert-butyl 1-O-propan-2-yl (2S,3S,6R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-4-oxooctanedioate (PubChem CID 10886253) has the molecular formula C27H54O8Si2 and a molecular weight of 562.89 g/mol. Its IUPAC name is 8-O-tert-butyl 1-O-propan-2-yl (2S,3S,6R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-4-oxooctanedioate.
| Compound Name | 8-O-tert-butyl 1-O-propan-2-yl (2S,3S,6R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-4-oxooctanedioate |
|---|---|
| PubChem CID | 10886253 |
| Molecular Formula | C27H54O8Si2 |
| Molecular Weight | 562.89 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | 8-O-tert-butyl 1-O-propan-2-yl (2S,3S,6R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-4-oxooctanedioate |
| SMILES | CC(C)OC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)C[C@@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H54O8Si2/c1-18(2)32-24(31)23(35-37(14,15)27(9,10)11)22(34-36(12,13)26(6,7)8)20(29)16-19(28)17-21(30)33-25(3,4)5/h18-19,22-23,28H,16-17H2,1-15H3/t19-,22-,23+/m1/s1 |
| InChIKey | XIKCKIDMXJJILP-PTUXOGIPSA-N |
| XLogP | 5.77 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.89 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|