C25H48O8Si2 — CID 15265820
8-O-tert-butyl 1-O-methyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dioxooctanedioate (PubChem CID 15265820) has the molecular formula C25H48O8Si2 and a molecular weight of 532.82 g/mol. Its IUPAC name is 8-O-tert-butyl 1-O-methyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dioxooctanedioate.
| Compound Name | 8-O-tert-butyl 1-O-methyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dioxooctanedioate |
|---|---|
| PubChem CID | 15265820 |
| Molecular Formula | C25H48O8Si2 |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 8-O-tert-butyl 1-O-methyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dioxooctanedioate |
| SMILES | COC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)CC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H48O8Si2/c1-23(2,3)31-19(28)16-17(26)15-18(27)20(32-34(11,12)24(4,5)6)21(22(29)30-10)33-35(13,14)25(7,8)9/h20-21H,15-16H2,1-14H3/t20-,21+/m0/s1 |
| InChIKey | VJKSJTGAZCQBIP-LEWJYISDSA-N |
| XLogP | 5.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|