C19H38O5Si — CID 11234201
tert-butyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate (PubChem CID 11234201) has the molecular formula C19H38O5Si and a molecular weight of 374.59 g/mol. Its IUPAC name is tert-butyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate.
| Compound Name | tert-butyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate |
|---|---|
| PubChem CID | 11234201 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | tert-butyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate |
| SMILES | CCC(=O)[C@@H](C)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38O5Si/c1-12-14(20)13(2)15(22-9)16(17(21)23-18(3,4)5)24-25(10,11)19(6,7)8/h13,15-16H,12H2,1-11H3/t13-,15+,16-/m1/s1 |
| InChIKey | RGYDRGDHQQDHCK-VNQPRFMTSA-N |
| XLogP | 4.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|