C28H58O5Si2 — CID 10929507
ethyl (2R,3S,4R)-4-methyl-6-oxo-2,3-bis[tri(propan-2-yl)silyloxy]heptanoate (PubChem CID 10929507) has the molecular formula C28H58O5Si2 and a molecular weight of 530.94 g/mol. Its IUPAC name is ethyl (2R,3S,4R)-4-methyl-6-oxo-2,3-bis[tri(propan-2-yl)silyloxy]heptanoate.
| Compound Name | ethyl (2R,3S,4R)-4-methyl-6-oxo-2,3-bis[tri(propan-2-yl)silyloxy]heptanoate |
|---|---|
| PubChem CID | 10929507 |
| Molecular Formula | C28H58O5Si2 |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | ethyl (2R,3S,4R)-4-methyl-6-oxo-2,3-bis[tri(propan-2-yl)silyloxy]heptanoate |
| SMILES | CCOC(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)CC(C)=O |
| InChI | InChI=1S/C28H58O5Si2/c1-16-31-28(30)27(33-35(21(8)9,22(10)11)23(12)13)26(24(14)17-25(15)29)32-34(18(2)3,19(4)5)20(6)7/h18-24,26-27H,16-17H2,1-15H3/t24-,26+,27-/m1/s1 |
| InChIKey | KYKVEKWDNJRXFC-FXVJXKIMSA-N |
| XLogP | 8.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|