C17H33ClO5Si — CID 11291960
2-chloroethyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate (PubChem CID 11291960) has the molecular formula C17H33ClO5Si and a molecular weight of 380.99 g/mol. Its IUPAC name is 2-chloroethyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate.
| Compound Name | 2-chloroethyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate |
|---|---|
| PubChem CID | 11291960 |
| Molecular Formula | C17H33ClO5Si |
| Molecular Weight | 380.99 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-chloroethyl (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methyl-5-oxoheptanoate |
| SMILES | CCC(=O)[C@@H](C)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OCCCl |
| InChI | InChI=1S/C17H33ClO5Si/c1-9-13(19)12(2)14(21-6)15(16(20)22-11-10-18)23-24(7,8)17(3,4)5/h12,14-15H,9-11H2,1-8H3/t12-,14+,15-/m1/s1 |
| InChIKey | LELDEGPQEIQEPN-VHDGCEQUSA-N |
| XLogP | 3.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.99 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|