C16H32O5Si — CID 10735356
diethyl (2R,3S)-2-pentyl-3-trimethylsilyloxybutanedioate (PubChem CID 10735356) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is diethyl (2R,3S)-2-pentyl-3-trimethylsilyloxybutanedioate.
| Compound Name | diethyl (2R,3S)-2-pentyl-3-trimethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 10735356 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | diethyl (2R,3S)-2-pentyl-3-trimethylsilyloxybutanedioate |
| SMILES | CCCCC[C@@H](C(=O)OCC)[C@H](O[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C16H32O5Si/c1-7-10-11-12-13(15(17)19-8-2)14(16(18)20-9-3)21-22(4,5)6/h13-14H,7-12H2,1-6H3/t13-,14+/m1/s1 |
| InChIKey | GMHMLMFMTSQCOU-KGLIPLIRSA-N |
| XLogP | 3.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|