C19H40O4Si — CID 135069748
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyloctanoate (PubChem CID 135069748) has the molecular formula C19H40O4Si and a molecular weight of 360.61 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyloctanoate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyloctanoate |
|---|---|
| PubChem CID | 135069748 |
| Molecular Formula | C19H40O4Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyloctanoate |
| SMILES | CCCCCC(C)(O)C(O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H40O4Si/c1-11-12-13-14-19(8,21)15(16(20)22-17(2,3)4)23-24(9,10)18(5,6)7/h15,21H,11-14H2,1-10H3 |
| InChIKey | BCWROBKWOYZYFK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|