C17H36O4Si — CID 135067868
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,4-dimethylpentanoate (PubChem CID 135067868) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,4-dimethylpentanoate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,4-dimethylpentanoate |
|---|---|
| PubChem CID | 135067868 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,4-dimethylpentanoate |
| SMILES | CC(C)C(C)(O)C(O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H36O4Si/c1-12(2)17(9,19)13(14(18)20-15(3,4)5)21-22(10,11)16(6,7)8/h12-13,19H,1-11H3 |
| InChIKey | PFMZVYZCZYSADC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|