C18H40O4Si2 — CID 134996947
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpentanoate (PubChem CID 134996947) has the molecular formula C18H40O4Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpentanoate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpentanoate |
|---|---|
| PubChem CID | 134996947 |
| Molecular Formula | C18H40O4Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpentanoate |
| SMILES | CC(C)(C)OC(=O)C(O[Si](C)(C)C(C)(C)C)C(O)CC[Si](C)(C)C |
| InChI | InChI=1S/C18H40O4Si2/c1-17(2,3)21-16(20)15(14(19)12-13-23(7,8)9)22-24(10,11)18(4,5)6/h14-15,19H,12-13H2,1-11H3 |
| InChIKey | CHSNEEFIKCSSAE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|