C15H32O4Si — CID 134996684
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methylbutanoate (PubChem CID 134996684) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methylbutanoate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 134996684 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(O[Si](C)(C)C(C)(C)C)C(C)(C)O |
| InChI | InChI=1S/C15H32O4Si/c1-13(2,3)18-12(16)11(15(7,8)17)19-20(9,10)14(4,5)6/h11,17H,1-10H3 |
| InChIKey | OKDPNLBMTKZDIG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|