C12H19F5O5Si — CID 156762045
2-butan-2-yloxycarbonyl-3,3,4,4,4-pentafluoro-2-trimethylsilyloxybutanoic acid (PubChem CID 156762045) has the molecular formula C12H19F5O5Si and a molecular weight of 366.36 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-3,3,4,4,4-pentafluoro-2-trimethylsilyloxybutanoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-3,3,4,4,4-pentafluoro-2-trimethylsilyloxybutanoic acid |
|---|---|
| PubChem CID | 156762045 |
| Molecular Formula | C12H19F5O5Si |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-3,3,4,4,4-pentafluoro-2-trimethylsilyloxybutanoic acid |
| SMILES | CCC(C)OC(=O)C(O[Si](C)(C)C)(C(=O)O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H19F5O5Si/c1-6-7(2)21-9(20)10(8(18)19,22-23(3,4)5)11(13,14)12(15,16)17/h7H,6H2,1-5H3,(H,18,19) |
| InChIKey | WQMDXSKKYHNCNL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|