C9H11F5O5 — CID 156761994
1-O-methyl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate (PubChem CID 156761994) has the molecular formula C9H11F5O5 and a molecular weight of 294.17 g/mol. Its IUPAC name is 1-O-methyl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate.
| Compound Name | 1-O-methyl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
|---|---|
| PubChem CID | 156761994 |
| Molecular Formula | C9H11F5O5 |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1-O-methyl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
| SMILES | CCCOC(=O)C(O)(C(=O)OC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F5O5/c1-3-4-19-6(16)7(17,5(15)18-2)8(10,11)9(12,13)14/h17H,3-4H2,1-2H3 |
| InChIKey | VZMRRZJIOFJHOD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|