C12H7F15O5 — CID 12504219
1-O-ethyl 3-O-[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate (PubChem CID 12504219) has the molecular formula C12H7F15O5 and a molecular weight of 516.15 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate.
| Compound Name | 1-O-ethyl 3-O-[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate |
|---|---|
| PubChem CID | 12504219 |
| Molecular Formula | C12H7F15O5 |
| Molecular Weight | 516.15 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | 1-O-ethyl 3-O-[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OC(C(F)(F)F)(C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7F15O5/c1-2-31-4(28)3(6(13,14)15)5(29)32-8(11(22,23)24,12(25,26)27)7(30,9(16,17)18)10(19,20)21/h3,30H,2H2,1H3 |
| InChIKey | SGDYHKGYQINYLR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|