C12H17F5O5 — CID 156762043
1-O-(2-methylpropyl) 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate (PubChem CID 156762043) has the molecular formula C12H17F5O5 and a molecular weight of 336.25 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate.
| Compound Name | 1-O-(2-methylpropyl) 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
|---|---|
| PubChem CID | 156762043 |
| Molecular Formula | C12H17F5O5 |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-O-(2-methylpropyl) 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
| SMILES | CCCOC(=O)C(O)(C(=O)OCC(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F5O5/c1-4-5-21-8(18)10(20,9(19)22-6-7(2)3)11(13,14)12(15,16)17/h7,20H,4-6H2,1-3H3 |
| InChIKey | MEOPRKHMRYCBAL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|