C10H14F4O5 — CID 20826485
2-(2,3,3,3-tetrafluoro-2-hydroxypropanoyl)oxyethyl 2-methylbutanoate (PubChem CID 20826485) has the molecular formula C10H14F4O5 and a molecular weight of 290.21 g/mol. Its IUPAC name is 2-(2,3,3,3-tetrafluoro-2-hydroxypropanoyl)oxyethyl 2-methylbutanoate.
| Compound Name | 2-(2,3,3,3-tetrafluoro-2-hydroxypropanoyl)oxyethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 20826485 |
| Molecular Formula | C10H14F4O5 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-(2,3,3,3-tetrafluoro-2-hydroxypropanoyl)oxyethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOC(=O)C(O)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F4O5/c1-3-6(2)7(15)18-4-5-19-8(16)9(11,17)10(12,13)14/h6,17H,3-5H2,1-2H3 |
| InChIKey | UXCVYVQBEZOWQA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|