C9H11F5O4 — CID 91694730
4-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxy)pentanoic acid (PubChem CID 91694730) has the molecular formula C9H11F5O4 and a molecular weight of 278.17 g/mol. Its IUPAC name is 4-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxy)pentanoic acid.
| Compound Name | 4-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 91694730 |
| Molecular Formula | C9H11F5O4 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxy)pentanoic acid |
| SMILES | CC(C)CC(OC(=O)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H11F5O4/c1-4(2)3-5(6(15)16)18-7(17)8(10,11)9(12,13)14/h4-5H,3H2,1-2H3,(H,15,16) |
| InChIKey | XEXKYFPORBOREK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|