C8H10F6O4 — CID 164747394
4,4,4-trifluoro-3-(2-methoxyethoxy)-3-(trifluoromethyl)butanoic acid (PubChem CID 164747394) has the molecular formula C8H10F6O4 and a molecular weight of 284.15 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(2-methoxyethoxy)-3-(trifluoromethyl)butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(2-methoxyethoxy)-3-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 164747394 |
| Molecular Formula | C8H10F6O4 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 4,4,4-trifluoro-3-(2-methoxyethoxy)-3-(trifluoromethyl)butanoic acid |
| SMILES | COCCOC(CC(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F6O4/c1-17-2-3-18-6(4-5(15)16,7(9,10)11)8(12,13)14/h2-4H2,1H3,(H,15,16) |
| InChIKey | VIWIMHOIGPHWLD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|