C10H12F6O6 — CID 139909054
2-[2,2,2-trifluoro-1-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]ethyl]propanedioic acid (PubChem CID 139909054) has the molecular formula C10H12F6O6 and a molecular weight of 342.19 g/mol. Its IUPAC name is 2-[2,2,2-trifluoro-1-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]ethyl]propanedioic acid.
| Compound Name | 2-[2,2,2-trifluoro-1-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]ethyl]propanedioic acid |
|---|---|
| PubChem CID | 139909054 |
| Molecular Formula | C10H12F6O6 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-[2,2,2-trifluoro-1-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]ethyl]propanedioic acid |
| SMILES | CC(OCCOC(C(C(=O)O)C(=O)O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6O6/c1-4(9(11,12)13)21-2-3-22-6(10(14,15)16)5(7(17)18)8(19)20/h4-6H,2-3H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | GBCYDAJQGHFGPI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|