C13H19F5O5 — CID 156762102
bis(2-methylpropyl) 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate (PubChem CID 156762102) has the molecular formula C13H19F5O5 and a molecular weight of 350.28 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate.
| Compound Name | bis(2-methylpropyl) 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
|---|---|
| PubChem CID | 156762102 |
| Molecular Formula | C13H19F5O5 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | bis(2-methylpropyl) 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
| SMILES | CC(C)COC(=O)C(O)(C(=O)OCC(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H19F5O5/c1-7(2)5-22-9(19)11(21,10(20)23-6-8(3)4)12(14,15)13(16,17)18/h7-8,21H,5-6H2,1-4H3 |
| InChIKey | XFHBBIQJUMSAAI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|