C16H3F27O6 — CID 134874690
bis[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate (PubChem CID 134874690) has the molecular formula C16H3F27O6 and a molecular weight of 804.14 g/mol. Its IUPAC name is bis[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate.
| Compound Name | bis[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate |
|---|---|
| PubChem CID | 134874690 |
| Molecular Formula | C16H3F27O6 |
| Molecular Weight | 804.14 g/mol |
| Exact Mass | 803.95 |
| IUPAC Name | bis[1,1,1,4,4,4-hexafluoro-3-hydroxy-2,3-bis(trifluoromethyl)butan-2-yl] 2-(trifluoromethyl)propanedioate |
| SMILES | O=C(OC(C(F)(F)F)(C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F)C(C(=O)OC(C(F)(F)F)(C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H3F27O6/c17-4(18,19)1(2(44)48-7(13(32,33)34,14(35,36)37)5(46,9(20,21)22)10(23,24)25)3(45)49-8(15(38,39)40,16(41,42)43)6(47,11(26,27)28)12(29,30)31/h1,46-47H |
| InChIKey | KOTMRWMEHRYIJM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.14 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|