C9H13F3O5 — CID 156762080
1-O-methyl 3-O-(2-methylpropyl) 2-hydroxy-2-(trifluoromethyl)propanedioate (PubChem CID 156762080) has the molecular formula C9H13F3O5 and a molecular weight of 258.19 g/mol. Its IUPAC name is 1-O-methyl 3-O-(2-methylpropyl) 2-hydroxy-2-(trifluoromethyl)propanedioate.
| Compound Name | 1-O-methyl 3-O-(2-methylpropyl) 2-hydroxy-2-(trifluoromethyl)propanedioate |
|---|---|
| PubChem CID | 156762080 |
| Molecular Formula | C9H13F3O5 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-O-methyl 3-O-(2-methylpropyl) 2-hydroxy-2-(trifluoromethyl)propanedioate |
| SMILES | COC(=O)C(O)(C(=O)OCC(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O5/c1-5(2)4-17-7(14)8(15,6(13)16-3)9(10,11)12/h5,15H,4H2,1-3H3 |
| InChIKey | VVHBFTBGKOZJCQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|