C16H34O4Si — CID 11652646
tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanoate (PubChem CID 11652646) has the molecular formula C16H34O4Si and a molecular weight of 318.53 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanoate.
| Compound Name | tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 11652646 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanoate |
| SMILES | CC(C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H34O4Si/c1-11(2)12(17)13(14(18)19-15(3,4)5)20-21(9,10)16(6,7)8/h11-13,17H,1-10H3/t12-,13-/m1/s1 |
| InChIKey | OJKCBXOGTBKPET-CHWSQXEVSA-N |
| XLogP | 3.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|