C20H42O4Si — CID 135012525
tert-butyl (2R,3R,4S)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxypentanoate (PubChem CID 135012525) has the molecular formula C20H42O4Si and a molecular weight of 374.64 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxypentanoate.
| Compound Name | tert-butyl (2R,3R,4S)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxypentanoate |
|---|---|
| PubChem CID | 135012525 |
| Molecular Formula | C20H42O4Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | tert-butyl (2R,3R,4S)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxypentanoate |
| SMILES | CC(C)[Si](O[C@H]([C@@H](C)CO)[C@@H](C)C(=O)OC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H42O4Si/c1-13(2)25(14(3)4,15(5)6)24-18(16(7)12-21)17(8)19(22)23-20(9,10)11/h13-18,21H,12H2,1-11H3/t16-,17+,18+/m0/s1 |
| InChIKey | KPHYXCYWWGJKJE-RCCFBDPRSA-N |
| XLogP | 5.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|