C14H28O6Si — CID 91155698
ethyl 4-[tert-butyl(dimethyl)silyl]peroxy-2-hydroxy-2-methyl-3-oxopentanoate (PubChem CID 91155698) has the molecular formula C14H28O6Si and a molecular weight of 320.46 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]peroxy-2-hydroxy-2-methyl-3-oxopentanoate.
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]peroxy-2-hydroxy-2-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 91155698 |
| Molecular Formula | C14H28O6Si |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]peroxy-2-hydroxy-2-methyl-3-oxopentanoate |
| SMILES | CCOC(=O)C(C)(O)C(=O)C(C)OO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O6Si/c1-9-18-12(16)14(6,17)11(15)10(2)19-20-21(7,8)13(3,4)5/h10,17H,9H2,1-8H3 |
| InChIKey | BHLDDYBEXARWTA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|