C18H36O5Si — CID 15605725
(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycarbonyl-2-methylnonanoic acid (PubChem CID 15605725) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycarbonyl-2-methylnonanoic acid.
| Compound Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycarbonyl-2-methylnonanoic acid |
|---|---|
| PubChem CID | 15605725 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycarbonyl-2-methylnonanoic acid |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)OC)[C@H](C)C(=O)O |
| InChI | InChI=1S/C18H36O5Si/c1-9-10-11-12-14(23-24(7,8)18(3,4)5)15(17(21)22-6)13(2)16(19)20/h13-15H,9-12H2,1-8H3,(H,19,20)/t13-,14-,15-/m0/s1 |
| InChIKey | KWLHHOHIAKITGS-KKUMJFAQSA-N |
| XLogP | 4.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|