C22H48O4Si2 — CID 42611786
ethyl (2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octanoate (PubChem CID 42611786) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is ethyl (2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octanoate.
| Compound Name | ethyl (2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octanoate |
|---|---|
| PubChem CID | 42611786 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | ethyl (2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octanoate |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C22H48O4Si2/c1-13-15-16-17-18(25-27(9,10)21(3,4)5)19(20(23)24-14-2)26-28(11,12)22(6,7)8/h18-19H,13-17H2,1-12H3/t18-,19+/m0/s1 |
| InChIKey | OICTWHTVQKMWFR-RBUKOAKNSA-N |
| XLogP | 6.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|