C24H44O5Si — CID 11015682
cis-(8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-oxacyclotetradecane-2,5,6-trione (PubChem CID 11015682) has the molecular formula C24H44O5Si and a molecular weight of 440.70 g/mol. Its IUPAC name is cis-(8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-oxacyclotetradecane-2,5,6-trione.
| Compound Name | cis-(8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-oxacyclotetradecane-2,5,6-trione |
|---|---|
| PubChem CID | 11015682 |
| Molecular Formula | C24H44O5Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | cis-(8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-oxacyclotetradecane-2,5,6-trione |
| SMILES | CCCCC[C@@H]1CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)C(=O)CCC(=O)O1 |
| InChI | InChI=1S/C24H44O5Si/c1-7-8-10-13-19-14-11-9-12-15-20(29-30(5,6)24(2,3)4)18-22(26)21(25)16-17-23(27)28-19/h19-20H,7-18H2,1-6H3/t19-,20-/m1/s1 |
| InChIKey | ZIOYCTSECBVPTJ-WOJBJXKFSA-N |
| XLogP | 6.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|