C27H54O5Si2 — CID 91350030
4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6-dione (PubChem CID 91350030) has the molecular formula C27H54O5Si2 and a molecular weight of 514.90 g/mol. Its IUPAC name is 4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6-dione.
| Compound Name | 4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 91350030 |
| Molecular Formula | C27H54O5Si2 |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | 4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6-dione |
| SMILES | CC[Si](CC)(CC)OC1CCCCCCCCOC(=O)CC(O[Si](CC)(CC)CC)CC(=O)C1 |
| InChI | InChI=1S/C27H54O5Si2/c1-7-33(8-2,9-3)31-25-19-17-15-13-14-16-18-20-30-27(29)23-26(22-24(28)21-25)32-34(10-4,11-5)12-6/h25-26H,7-23H2,1-6H3 |
| InChIKey | VQOVDRVEEGCNDK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|