C20H40O4Si — CID 15259814
methyl (3R)-4-[(2S,3R)-3-butyloxiran-2-yl]-3-tri(propan-2-yl)silyloxybutanoate (PubChem CID 15259814) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is methyl (3R)-4-[(2S,3R)-3-butyloxiran-2-yl]-3-tri(propan-2-yl)silyloxybutanoate.
| Compound Name | methyl (3R)-4-[(2S,3R)-3-butyloxiran-2-yl]-3-tri(propan-2-yl)silyloxybutanoate |
|---|---|
| PubChem CID | 15259814 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | methyl (3R)-4-[(2S,3R)-3-butyloxiran-2-yl]-3-tri(propan-2-yl)silyloxybutanoate |
| SMILES | CCCC[C@H]1O[C@H]1C[C@H](CC(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-9-10-11-18-19(23-18)12-17(13-20(21)22-8)24-25(14(2)3,15(4)5)16(6)7/h14-19H,9-13H2,1-8H3/t17-,18-,19+/m1/s1 |
| InChIKey | LVPSVMPCJPEUIZ-QRVBRYPASA-N |
| XLogP | 5.46 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|