C23H46O6Si2 — CID 14262402
methyl (3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hexanoate (PubChem CID 14262402) has the molecular formula C23H46O6Si2 and a molecular weight of 474.79 g/mol. Its IUPAC name is methyl (3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hexanoate.
| Compound Name | methyl (3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hexanoate |
|---|---|
| PubChem CID | 14262402 |
| Molecular Formula | C23H46O6Si2 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | methyl (3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-5-oxooxolan-2-yl]hexanoate |
| SMILES | COC(=O)C[C@H](C[C@H](C[C@@H]1CCC(=O)O1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O6Si2/c1-22(2,3)30(8,9)28-18(14-17-12-13-20(24)27-17)15-19(16-21(25)26-7)29-31(10,11)23(4,5)6/h17-19H,12-16H2,1-11H3/t17-,18-,19-/m0/s1 |
| InChIKey | NQYDYNMFBLJTLC-FHWLQOOXSA-N |
| XLogP | 5.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|