C22H46O5Si2 — CID 134872932
(5S)-5-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl]oxolan-2-one (PubChem CID 134872932) has the molecular formula C22H46O5Si2 and a molecular weight of 446.78 g/mol. Its IUPAC name is (5S)-5-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl]oxolan-2-one.
| Compound Name | (5S)-5-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl]oxolan-2-one |
|---|---|
| PubChem CID | 134872932 |
| Molecular Formula | C22H46O5Si2 |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (5S)-5-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCO)C[C@H](C[C@@H]1CCC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O5Si2/c1-21(2,3)28(7,8)26-18(13-14-23)16-19(15-17-11-12-20(24)25-17)27-29(9,10)22(4,5)6/h17-19,23H,11-16H2,1-10H3/t17-,18+,19-/m0/s1 |
| InChIKey | GTNMKKMZHBJXMB-OTWHNJEPSA-N |
| XLogP | 5.64 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|