C17H34O7Si — CID 91320970
dimethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynonanedioate (PubChem CID 91320970) has the molecular formula C17H34O7Si and a molecular weight of 378.54 g/mol. Its IUPAC name is dimethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynonanedioate.
| Compound Name | dimethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynonanedioate |
|---|---|
| PubChem CID | 91320970 |
| Molecular Formula | C17H34O7Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | dimethyl (3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynonanedioate |
| SMILES | COC(=O)C[C@@H](O)CC(C[C@H](O)CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O7Si/c1-17(2,3)25(6,7)24-14(8-12(18)10-15(20)22-4)9-13(19)11-16(21)23-5/h12-14,18-19H,8-11H2,1-7H3/t12-,13-/m0/s1 |
| InChIKey | ONFAUDKJQNGKHD-STQMWFEESA-N |
| XLogP | 2.01 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|