C21H40O7 — CID 132551411
[(3R,5R)-3-hydroxy-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate (PubChem CID 132551411) has the molecular formula C21H40O7 and a molecular weight of 404.54 g/mol. Its IUPAC name is [(3R,5R)-3-hydroxy-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate.
| Compound Name | [(3R,5R)-3-hydroxy-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate |
|---|---|
| PubChem CID | 132551411 |
| Molecular Formula | C21H40O7 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | [(3R,5R)-3-hydroxy-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate |
| SMILES | CCCCC[C@@H](O)C[C@@H](O)CC(=O)O[C@H](CCCCC)C[C@@H](O)CC(=O)OC |
| InChI | InChI=1S/C21H40O7/c1-4-6-8-10-16(22)12-17(23)15-21(26)28-19(11-9-7-5-2)13-18(24)14-20(25)27-3/h16-19,22-24H,4-15H2,1-3H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | RNQUQFJBAHNFCZ-NCXUSEDFSA-N |
| XLogP | 2.87 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|