C20H44O5Si2 — CID 86598272
methyl (5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxyheptanoate (PubChem CID 86598272) has the molecular formula C20H44O5Si2 and a molecular weight of 420.74 g/mol. Its IUPAC name is methyl (5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxyheptanoate.
| Compound Name | methyl (5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxyheptanoate |
|---|---|
| PubChem CID | 86598272 |
| Molecular Formula | C20H44O5Si2 |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | methyl (5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxyheptanoate |
| SMILES | COC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O5Si2/c1-19(2,3)26(8,9)24-16(13-12-14-18(22)23-7)17(15-21)25-27(10,11)20(4,5)6/h16-17,21H,12-15H2,1-11H3/t16-,17+/m0/s1 |
| InChIKey | OBCLEAJFVVRXQA-DLBZAZTESA-N |
| XLogP | 5.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|