C17H36O5Si — CID 134930704
methyl (3R,5R,6R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyheptanoate (PubChem CID 134930704) has the molecular formula C17H36O5Si and a molecular weight of 348.56 g/mol. Its IUPAC name is methyl (3R,5R,6R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyheptanoate.
| Compound Name | methyl (3R,5R,6R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyheptanoate |
|---|---|
| PubChem CID | 134930704 |
| Molecular Formula | C17H36O5Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (3R,5R,6R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyheptanoate |
| SMILES | COC(=O)C[C@H](O)C[C@@H](O)[C@@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H36O5Si/c1-11(2)23(12(3)4,13(5)6)22-14(7)16(19)9-15(18)10-17(20)21-8/h11-16,18-19H,9-10H2,1-8H3/t14-,15-,16-/m1/s1 |
| InChIKey | KMZFLYZZRWJVHS-BZUAXINKSA-N |
| XLogP | 3.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|