C19H40O5Si — CID 11485711
tert-butyl (3R,5S)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 11485711) has the molecular formula C19H40O5Si and a molecular weight of 376.61 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | tert-butyl (3R,5S)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 11485711 |
| Molecular Formula | C19H40O5Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | tert-butyl (3R,5S)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | CC(C)[Si](OC[C@@H](O)C[C@@H](O)CC(=O)OC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H40O5Si/c1-13(2)25(14(3)4,15(5)6)23-12-17(21)10-16(20)11-18(22)24-19(7,8)9/h13-17,20-21H,10-12H2,1-9H3/t16-,17+/m1/s1 |
| InChIKey | RHIVPNONUUUZLI-SJORKVTESA-N |
| XLogP | 4.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|